| Type: | Organic raw materials/esters/organic acid esters |
| Product name: | Methyl hydrazinocarboxylate |
| CAS NO: | 6294-89-9 |
| Molecular weight: | 90.0812 |
| EC NO: | 228-560-3 |
| Molecular formula: | C2H6N2O2 |
| InChI: | InChI=1/C2H6N2O2/c1-6-2(5)4-3/h3H2,1H3,(H,4,5) |
| Product description: | Methyl hydrazinocarboxylate Appearance White crystal 99.5 Melting point, ℃ 73-76 Insoluble matter≤0.02% Combustion residue≤0.02% Moisture content≤0.02% PH value of 10% aqueous solution at 25℃ 8.20 Color of 12% aqueous solution≤8 Chloride ion, ppm ≤5 sulfate fluoride ion, ppm ≤5 sulfide ion, ppm ≤20 silicon ion, ppm ≤10 copper ion, ppm ≤1 total heavy metal ion content, ppm ≤10 |
| Alias: | Carbohydrazide methyl; Methoxycarbazide; Methyl hydrazine formate; Hydrazine methylformate; Methoxycarbonyl hydrazide |
| Structural formula: |  |